C12H19ClN2O3S — CID 120622618
5-amino-N,2-dimethyl-N-(2-methylsulfonylethyl)benzamide;hydrochloride (PubChem CID 120622618) has the molecular formula C12H19ClN2O3S and a molecular weight of 306.81 g/mol. Its IUPAC name is 5-amino-N,2-dimethyl-N-(2-methylsulfonylethyl)benzamide;hydrochloride.
| Compound Name | 5-amino-N,2-dimethyl-N-(2-methylsulfonylethyl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 120622618 |
| Molecular Formula | C12H19ClN2O3S |
| Molecular Weight | 306.81 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | 5-amino-N,2-dimethyl-N-(2-methylsulfonylethyl)benzamide;hydrochloride |
| SMILES | Cc1ccc(N)cc1C(=O)N(C)CCS(C)(=O)=O.Cl |
| InChI | InChI=1S/C12H18N2O3S.ClH/c1-9-4-5-10(13)8-11(9)12(15)14(2)6-7-18(3,16)17;/h4-5,8H,6-7,13H2,1-3H3;1H |
| InChIKey | YCPZYCXJYSPVLV-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.81 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|