C15H24ClN3O2 — CID 120618559
5-amino-N-[2-(tert-butylamino)-2-oxoethyl]-N,2-dimethylbenzamide;hydrochloride (PubChem CID 120618559) has the molecular formula C15H24ClN3O2 and a molecular weight of 313.83 g/mol. Its IUPAC name is 5-amino-N-[2-(tert-butylamino)-2-oxoethyl]-N,2-dimethylbenzamide;hydrochloride.
| Compound Name | 5-amino-N-[2-(tert-butylamino)-2-oxoethyl]-N,2-dimethylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 120618559 |
| Molecular Formula | C15H24ClN3O2 |
| Molecular Weight | 313.83 g/mol |
| Exact Mass | 313.16 |
| IUPAC Name | 5-amino-N-[2-(tert-butylamino)-2-oxoethyl]-N,2-dimethylbenzamide;hydrochloride |
| SMILES | Cc1ccc(N)cc1C(=O)N(C)CC(=O)NC(C)(C)C.Cl |
| InChI | InChI=1S/C15H23N3O2.ClH/c1-10-6-7-11(16)8-12(10)14(20)18(5)9-13(19)17-15(2,3)4;/h6-8H,9,16H2,1-5H3,(H,17,19);1H |
| InChIKey | RQCOWQMOUWNGEL-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.83 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|