C14H18Br2N2O2 — CID 103882161
2,4-dibromo-N-[2-(tert-butylamino)-2-oxoethyl]-N-methylbenzamide (PubChem CID 103882161) has the molecular formula C14H18Br2N2O2 and a molecular weight of 406.12 g/mol. Its IUPAC name is 2,4-dibromo-N-[2-(tert-butylamino)-2-oxoethyl]-N-methylbenzamide.
| Compound Name | 2,4-dibromo-N-[2-(tert-butylamino)-2-oxoethyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 103882161 |
| Molecular Formula | C14H18Br2N2O2 |
| Molecular Weight | 406.12 g/mol |
| Exact Mass | 403.97 |
| IUPAC Name | 2,4-dibromo-N-[2-(tert-butylamino)-2-oxoethyl]-N-methylbenzamide |
| SMILES | CN(CC(=O)NC(C)(C)C)C(=O)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C14H18Br2N2O2/c1-14(2,3)17-12(19)8-18(4)13(20)10-6-5-9(15)7-11(10)16/h5-7H,8H2,1-4H3,(H,17,19) |
| InChIKey | GFHVKMJDTGUPGO-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.12 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |