C16H26N2O — CID 61291739
5-amino-2-methyl-N,N-bis(2-methylpropyl)benzamide (PubChem CID 61291739) has the molecular formula C16H26N2O and a molecular weight of 262.40 g/mol. Its IUPAC name is 5-amino-2-methyl-N,N-bis(2-methylpropyl)benzamide.
| Compound Name | 5-amino-2-methyl-N,N-bis(2-methylpropyl)benzamide |
|---|---|
| PubChem CID | 61291739 |
| Molecular Formula | C16H26N2O |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.20 |
| IUPAC Name | 5-amino-2-methyl-N,N-bis(2-methylpropyl)benzamide |
| SMILES | Cc1ccc(N)cc1C(=O)N(CC(C)C)CC(C)C |
| InChI | InChI=1S/C16H26N2O/c1-11(2)9-18(10-12(3)4)16(19)15-8-14(17)7-6-13(15)5/h6-8,11-12H,9-10,17H2,1-5H3 |
| InChIKey | UMDCYMBSNUVVGD-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|