C16H24FNO — CID 112702512
4-fluoro-2-methyl-N,N-bis(2-methylpropyl)benzamide (PubChem CID 112702512) has the molecular formula C16H24FNO and a molecular weight of 265.37 g/mol. Its IUPAC name is 4-fluoro-2-methyl-N,N-bis(2-methylpropyl)benzamide.
| Compound Name | 4-fluoro-2-methyl-N,N-bis(2-methylpropyl)benzamide |
|---|---|
| PubChem CID | 112702512 |
| Molecular Formula | C16H24FNO |
| Molecular Weight | 265.37 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | 4-fluoro-2-methyl-N,N-bis(2-methylpropyl)benzamide |
| SMILES | Cc1cc(F)ccc1C(=O)N(CC(C)C)CC(C)C |
| InChI | InChI=1S/C16H24FNO/c1-11(2)9-18(10-12(3)4)16(19)15-7-6-14(17)8-13(15)5/h6-8,11-12H,9-10H2,1-5H3 |
| InChIKey | MFXGVUDBIXLHFZ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.37 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |