C15H23ClN2O — CID 43587105
4-amino-2-chloro-N,N-bis(2-methylpropyl)benzamide (PubChem CID 43587105) has the molecular formula C15H23ClN2O and a molecular weight of 282.81 g/mol. Its IUPAC name is 4-amino-2-chloro-N,N-bis(2-methylpropyl)benzamide.
| Compound Name | 4-amino-2-chloro-N,N-bis(2-methylpropyl)benzamide |
|---|---|
| PubChem CID | 43587105 |
| Molecular Formula | C15H23ClN2O |
| Molecular Weight | 282.81 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 4-amino-2-chloro-N,N-bis(2-methylpropyl)benzamide |
| SMILES | CC(C)CN(CC(C)C)C(=O)c1ccc(N)cc1Cl |
| InChI | InChI=1S/C15H23ClN2O/c1-10(2)8-18(9-11(3)4)15(19)13-6-5-12(17)7-14(13)16/h5-7,10-11H,8-9,17H2,1-4H3 |
| InChIKey | KPBNVRVYIPQNRI-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.81 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|