C14H18N2O — CID 61291356
5-amino-2-methyl-N,N-bis(prop-2-enyl)benzamide (PubChem CID 61291356) has the molecular formula C14H18N2O and a molecular weight of 230.31 g/mol. Its IUPAC name is 5-amino-2-methyl-N,N-bis(prop-2-enyl)benzamide.
| Compound Name | 5-amino-2-methyl-N,N-bis(prop-2-enyl)benzamide |
|---|---|
| PubChem CID | 61291356 |
| Molecular Formula | C14H18N2O |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | 5-amino-2-methyl-N,N-bis(prop-2-enyl)benzamide |
| SMILES | C=CCN(CC=C)C(=O)c1cc(N)ccc1C |
| InChI | InChI=1S/C14H18N2O/c1-4-8-16(9-5-2)14(17)13-10-12(15)7-6-11(13)3/h4-7,10H,1-2,8-9,15H2,3H3 |
| InChIKey | QLIZLYIAIRWDGU-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|