C12H15NOS — CID 107033475
N,2-dimethyl-N-prop-2-enyl-5-sulfanylbenzamide (PubChem CID 107033475) has the molecular formula C12H15NOS and a molecular weight of 221.32 g/mol. Its IUPAC name is N,2-dimethyl-N-prop-2-enyl-5-sulfanylbenzamide.
| Compound Name | N,2-dimethyl-N-prop-2-enyl-5-sulfanylbenzamide |
|---|---|
| PubChem CID | 107033475 |
| Molecular Formula | C12H15NOS |
| Molecular Weight | 221.32 g/mol |
| Exact Mass | 221.09 |
| IUPAC Name | N,2-dimethyl-N-prop-2-enyl-5-sulfanylbenzamide |
| SMILES | C=CCN(C)C(=O)c1cc(S)ccc1C |
| InChI | InChI=1S/C12H15NOS/c1-4-7-13(3)12(14)11-8-10(15)6-5-9(11)2/h4-6,8,15H,1,7H2,2-3H3 |
| InChIKey | DVGVBDAYJBOMDW-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.32 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|