C12H17NO2S — CID 107028262
N-(2-hydroxypropyl)-N,2-dimethyl-5-sulfanylbenzamide (PubChem CID 107028262) has the molecular formula C12H17NO2S and a molecular weight of 239.34 g/mol. Its IUPAC name is N-(2-hydroxypropyl)-N,2-dimethyl-5-sulfanylbenzamide.
| Compound Name | N-(2-hydroxypropyl)-N,2-dimethyl-5-sulfanylbenzamide |
|---|---|
| PubChem CID | 107028262 |
| Molecular Formula | C12H17NO2S |
| Molecular Weight | 239.34 g/mol |
| Exact Mass | 239.10 |
| IUPAC Name | N-(2-hydroxypropyl)-N,2-dimethyl-5-sulfanylbenzamide |
| SMILES | Cc1ccc(S)cc1C(=O)N(C)CC(C)O |
| InChI | InChI=1S/C12H17NO2S/c1-8-4-5-10(16)6-11(8)12(15)13(3)7-9(2)14/h4-6,9,14,16H,7H2,1-3H3 |
| InChIKey | KTGZIJWCOBVCAK-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.34 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|