C11H15NO2S — CID 107023651
N-(2-hydroxyethyl)-N,2-dimethyl-5-sulfanylbenzamide (PubChem CID 107023651) has the molecular formula C11H15NO2S and a molecular weight of 225.31 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-N,2-dimethyl-5-sulfanylbenzamide.
| Compound Name | N-(2-hydroxyethyl)-N,2-dimethyl-5-sulfanylbenzamide |
|---|---|
| PubChem CID | 107023651 |
| Molecular Formula | C11H15NO2S |
| Molecular Weight | 225.31 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | N-(2-hydroxyethyl)-N,2-dimethyl-5-sulfanylbenzamide |
| SMILES | Cc1ccc(S)cc1C(=O)N(C)CCO |
| InChI | InChI=1S/C11H15NO2S/c1-8-3-4-9(15)7-10(8)11(14)12(2)5-6-13/h3-4,7,13,15H,5-6H2,1-2H3 |
| InChIKey | GALZOYJZOUZBSD-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.31 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|