C10H13NOS — CID 107021651
N,N,2-trimethyl-5-sulfanylbenzamide (PubChem CID 107021651) has the molecular formula C10H13NOS and a molecular weight of 195.29 g/mol. Its IUPAC name is N,N,2-trimethyl-5-sulfanylbenzamide.
| Compound Name | N,N,2-trimethyl-5-sulfanylbenzamide |
|---|---|
| PubChem CID | 107021651 |
| Molecular Formula | C10H13NOS |
| Molecular Weight | 195.29 g/mol |
| Exact Mass | 195.07 |
| IUPAC Name | N,N,2-trimethyl-5-sulfanylbenzamide |
| SMILES | Cc1ccc(S)cc1C(=O)N(C)C |
| InChI | InChI=1S/C10H13NOS/c1-7-4-5-8(13)6-9(7)10(12)11(2)3/h4-6,13H,1-3H3 |
| InChIKey | BCSLDADDEWUVRB-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.29 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|