C16H14N2OS — CID 107028995
N-(4-cyanophenyl)-N,2-dimethyl-5-sulfanylbenzamide (PubChem CID 107028995) has the molecular formula C16H14N2OS and a molecular weight of 282.37 g/mol. Its IUPAC name is N-(4-cyanophenyl)-N,2-dimethyl-5-sulfanylbenzamide.
| Compound Name | N-(4-cyanophenyl)-N,2-dimethyl-5-sulfanylbenzamide |
|---|---|
| PubChem CID | 107028995 |
| Molecular Formula | C16H14N2OS |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | N-(4-cyanophenyl)-N,2-dimethyl-5-sulfanylbenzamide |
| SMILES | Cc1ccc(S)cc1C(=O)N(C)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C16H14N2OS/c1-11-3-8-14(20)9-15(11)16(19)18(2)13-6-4-12(10-17)5-7-13/h3-9,20H,1-2H3 |
| InChIKey | HFQAHJQRYOBMSZ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 44.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|