C14H12N2OS — CID 55141574
N-(4-cyanophenyl)-N,5-dimethylthiophene-2-carboxamide (PubChem CID 55141574) has the molecular formula C14H12N2OS and a molecular weight of 256.33 g/mol. Its IUPAC name is N-(4-cyanophenyl)-N,5-dimethylthiophene-2-carboxamide.
| Compound Name | N-(4-cyanophenyl)-N,5-dimethylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 55141574 |
| Molecular Formula | C14H12N2OS |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | N-(4-cyanophenyl)-N,5-dimethylthiophene-2-carboxamide |
| SMILES | Cc1ccc(C(=O)N(C)c2ccc(C#N)cc2)s1 |
| InChI | InChI=1S/C14H12N2OS/c1-10-3-8-13(18-10)14(17)16(2)12-6-4-11(9-15)5-7-12/h3-8H,1-2H3 |
| InChIKey | ZSFBQLJINYPKHJ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |