C7H10N2OS — CID 90946987
N,5-dimethylthiophene-2-carbohydrazide (PubChem CID 90946987) has the molecular formula C7H10N2OS and a molecular weight of 170.24 g/mol. Its IUPAC name is N,5-dimethylthiophene-2-carbohydrazide.
| Compound Name | N,5-dimethylthiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 90946987 |
| Molecular Formula | C7H10N2OS |
| Molecular Weight | 170.24 g/mol |
| Exact Mass | 170.05 |
| IUPAC Name | N,5-dimethylthiophene-2-carbohydrazide |
| SMILES | Cc1ccc(C(=O)N(C)N)s1 |
| InChI | InChI=1S/C7H10N2OS/c1-5-3-4-6(11-5)7(10)9(2)8/h3-4H,8H2,1-2H3 |
| InChIKey | VTEHSHFJDYIINT-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.24 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|