C11H15NO3 — CID 60652527
2-hydroxy-N-(2-hydroxyethyl)-N,5-dimethylbenzamide (PubChem CID 60652527) has the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. Its IUPAC name is 2-hydroxy-N-(2-hydroxyethyl)-N,5-dimethylbenzamide.
| Compound Name | 2-hydroxy-N-(2-hydroxyethyl)-N,5-dimethylbenzamide |
|---|---|
| PubChem CID | 60652527 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | 2-hydroxy-N-(2-hydroxyethyl)-N,5-dimethylbenzamide |
| SMILES | Cc1ccc(O)c(C(=O)N(C)CCO)c1 |
| InChI | InChI=1S/C11H15NO3/c1-8-3-4-10(14)9(7-8)11(15)12(2)5-6-13/h3-4,7,13-14H,5-6H2,1-2H3 |
| InChIKey | KHSITUFGRWLFSO-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |