C18H21NO4 — CID 31284888
2-hydroxy-N-[2-(4-methoxyphenoxy)ethyl]-N,5-dimethylbenzamide (PubChem CID 31284888) has the molecular formula C18H21NO4 and a molecular weight of 315.37 g/mol. Its IUPAC name is 2-hydroxy-N-[2-(4-methoxyphenoxy)ethyl]-N,5-dimethylbenzamide.
| Compound Name | 2-hydroxy-N-[2-(4-methoxyphenoxy)ethyl]-N,5-dimethylbenzamide |
|---|---|
| PubChem CID | 31284888 |
| Molecular Formula | C18H21NO4 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | 2-hydroxy-N-[2-(4-methoxyphenoxy)ethyl]-N,5-dimethylbenzamide |
| SMILES | COc1ccc(OCCN(C)C(=O)c2cc(C)ccc2O)cc1 |
| InChI | InChI=1S/C18H21NO4/c1-13-4-9-17(20)16(12-13)18(21)19(2)10-11-23-15-7-5-14(22-3)6-8-15/h4-9,12,20H,10-11H2,1-3H3 |
| InChIKey | DMAKXTQBZHRWDJ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |