C19H22N2O6 — CID 31641398
4,5-dimethoxy-N-methyl-N-[2-(4-methylphenoxy)ethyl]-2-nitrobenzamide (PubChem CID 31641398) has the molecular formula C19H22N2O6 and a molecular weight of 374.39 g/mol. Its IUPAC name is 4,5-dimethoxy-N-methyl-N-[2-(4-methylphenoxy)ethyl]-2-nitrobenzamide.
| Compound Name | 4,5-dimethoxy-N-methyl-N-[2-(4-methylphenoxy)ethyl]-2-nitrobenzamide |
|---|---|
| PubChem CID | 31641398 |
| Molecular Formula | C19H22N2O6 |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | 4,5-dimethoxy-N-methyl-N-[2-(4-methylphenoxy)ethyl]-2-nitrobenzamide |
| SMILES | COc1cc(C(=O)N(C)CCOc2ccc(C)cc2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C19H22N2O6/c1-13-5-7-14(8-6-13)27-10-9-20(2)19(22)15-11-17(25-3)18(26-4)12-16(15)21(23)24/h5-8,11-12H,9-10H2,1-4H3 |
| InChIKey | RJVLQUNRIFYQMS-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 91.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|