C19H20F2N2O5 — CID 32895805
4-(difluoromethoxy)-N-[(2,4-dimethylphenyl)methyl]-5-methoxy-N-methyl-2-nitrobenzamide (PubChem CID 32895805) has the molecular formula C19H20F2N2O5 and a molecular weight of 394.37 g/mol. Its IUPAC name is 4-(difluoromethoxy)-N-[(2,4-dimethylphenyl)methyl]-5-methoxy-N-methyl-2-nitrobenzamide.
| Compound Name | 4-(difluoromethoxy)-N-[(2,4-dimethylphenyl)methyl]-5-methoxy-N-methyl-2-nitrobenzamide |
|---|---|
| PubChem CID | 32895805 |
| Molecular Formula | C19H20F2N2O5 |
| Molecular Weight | 394.37 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | 4-(difluoromethoxy)-N-[(2,4-dimethylphenyl)methyl]-5-methoxy-N-methyl-2-nitrobenzamide |
| SMILES | COc1cc(C(=O)N(C)Cc2ccc(C)cc2C)c([N+](=O)[O-])cc1OC(F)F |
| InChI | InChI=1S/C19H20F2N2O5/c1-11-5-6-13(12(2)7-11)10-22(3)18(24)14-8-16(27-4)17(28-19(20)21)9-15(14)23(25)26/h5-9,19H,10H2,1-4H3 |
| InChIKey | PSJUPHKHEKVCOZ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.37 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|