C14H11F5N2O5 — CID 86849761
4-(difluoromethoxy)-5-methoxy-2-nitro-N-prop-2-ynyl-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 86849761) has the molecular formula C14H11F5N2O5 and a molecular weight of 382.24 g/mol. Its IUPAC name is 4-(difluoromethoxy)-5-methoxy-2-nitro-N-prop-2-ynyl-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 4-(difluoromethoxy)-5-methoxy-2-nitro-N-prop-2-ynyl-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 86849761 |
| Molecular Formula | C14H11F5N2O5 |
| Molecular Weight | 382.24 g/mol |
| Exact Mass | 382.06 |
| IUPAC Name | 4-(difluoromethoxy)-5-methoxy-2-nitro-N-prop-2-ynyl-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | C#CCN(CC(F)(F)F)C(=O)c1cc(OC)c(OC(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H11F5N2O5/c1-3-4-20(7-14(17,18)19)12(22)8-5-10(25-2)11(26-13(15)16)6-9(8)21(23)24/h1,5-6,13H,4,7H2,2H3 |
| InChIKey | DFIVOIXEHHYRQW-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.24 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|