C18H15F5N2O6 — CID 24661002
4-(difluoromethoxy)-5-methoxy-N-methyl-2-nitro-N-[[2-(trifluoromethoxy)phenyl]methyl]benzamide (PubChem CID 24661002) has the molecular formula C18H15F5N2O6 and a molecular weight of 450.32 g/mol. Its IUPAC name is 4-(difluoromethoxy)-5-methoxy-N-methyl-2-nitro-N-[[2-(trifluoromethoxy)phenyl]methyl]benzamide.
| Compound Name | 4-(difluoromethoxy)-5-methoxy-N-methyl-2-nitro-N-[[2-(trifluoromethoxy)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 24661002 |
| Molecular Formula | C18H15F5N2O6 |
| Molecular Weight | 450.32 g/mol |
| Exact Mass | 450.09 |
| IUPAC Name | 4-(difluoromethoxy)-5-methoxy-N-methyl-2-nitro-N-[[2-(trifluoromethoxy)phenyl]methyl]benzamide |
| SMILES | COc1cc(C(=O)N(C)Cc2ccccc2OC(F)(F)F)c([N+](=O)[O-])cc1OC(F)F |
| InChI | InChI=1S/C18H15F5N2O6/c1-24(9-10-5-3-4-6-13(10)31-18(21,22)23)16(26)11-7-14(29-2)15(30-17(19)20)8-12(11)25(27)28/h3-8,17H,9H2,1-2H3 |
| InChIKey | PGNNJUPMFUFRSH-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 91.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.32 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|