C13H15F2N3O6 — CID 24654795
4-(difluoromethoxy)-N-[2-(dimethylamino)-2-oxoethyl]-5-methoxy-2-nitrobenzamide (PubChem CID 24654795) has the molecular formula C13H15F2N3O6 and a molecular weight of 347.27 g/mol. Its IUPAC name is 4-(difluoromethoxy)-N-[2-(dimethylamino)-2-oxoethyl]-5-methoxy-2-nitrobenzamide.
| Compound Name | 4-(difluoromethoxy)-N-[2-(dimethylamino)-2-oxoethyl]-5-methoxy-2-nitrobenzamide |
|---|---|
| PubChem CID | 24654795 |
| Molecular Formula | C13H15F2N3O6 |
| Molecular Weight | 347.27 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | 4-(difluoromethoxy)-N-[2-(dimethylamino)-2-oxoethyl]-5-methoxy-2-nitrobenzamide |
| SMILES | COc1cc(C(=O)NCC(=O)N(C)C)c([N+](=O)[O-])cc1OC(F)F |
| InChI | InChI=1S/C13H15F2N3O6/c1-17(2)11(19)6-16-12(20)7-4-9(23-3)10(24-13(14)15)5-8(7)18(21)22/h4-5,13H,6H2,1-3H3,(H,16,20) |
| InChIKey | NCPHPUSJHMTCMW-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.27 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|