C11H13F2NO2 — CID 115611587
N-(2,2-difluoroethyl)-2-hydroxy-N,5-dimethylbenzamide (PubChem CID 115611587) has the molecular formula C11H13F2NO2 and a molecular weight of 229.23 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-2-hydroxy-N,5-dimethylbenzamide.
| Compound Name | N-(2,2-difluoroethyl)-2-hydroxy-N,5-dimethylbenzamide |
|---|---|
| PubChem CID | 115611587 |
| Molecular Formula | C11H13F2NO2 |
| Molecular Weight | 229.23 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | N-(2,2-difluoroethyl)-2-hydroxy-N,5-dimethylbenzamide |
| SMILES | Cc1ccc(O)c(C(=O)N(C)CC(F)F)c1 |
| InChI | InChI=1S/C11H13F2NO2/c1-7-3-4-9(15)8(5-7)11(16)14(2)6-10(12)13/h3-5,10,15H,6H2,1-2H3 |
| InChIKey | DZINJOIUANODHU-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.23 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |