C10H10ClF2NO2 — CID 115611590
4-chloro-N-(2,2-difluoroethyl)-2-hydroxy-N-methylbenzamide (PubChem CID 115611590) has the molecular formula C10H10ClF2NO2 and a molecular weight of 249.64 g/mol. Its IUPAC name is 4-chloro-N-(2,2-difluoroethyl)-2-hydroxy-N-methylbenzamide.
| Compound Name | 4-chloro-N-(2,2-difluoroethyl)-2-hydroxy-N-methylbenzamide |
|---|---|
| PubChem CID | 115611590 |
| Molecular Formula | C10H10ClF2NO2 |
| Molecular Weight | 249.64 g/mol |
| Exact Mass | 249.04 |
| IUPAC Name | 4-chloro-N-(2,2-difluoroethyl)-2-hydroxy-N-methylbenzamide |
| SMILES | CN(CC(F)F)C(=O)c1ccc(Cl)cc1O |
| InChI | InChI=1S/C10H10ClF2NO2/c1-14(5-9(12)13)10(16)7-3-2-6(11)4-8(7)15/h2-4,9,15H,5H2,1H3 |
| InChIKey | QTTQDYZDPBBANT-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.64 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |