C14H21ClN2O2 — CID 103189268
4-chloro-N-[1-(dimethylamino)propan-2-yl]-N-ethyl-2-hydroxybenzamide (PubChem CID 103189268) has the molecular formula C14H21ClN2O2 and a molecular weight of 284.79 g/mol. Its IUPAC name is 4-chloro-N-[1-(dimethylamino)propan-2-yl]-N-ethyl-2-hydroxybenzamide.
| Compound Name | 4-chloro-N-[1-(dimethylamino)propan-2-yl]-N-ethyl-2-hydroxybenzamide |
|---|---|
| PubChem CID | 103189268 |
| Molecular Formula | C14H21ClN2O2 |
| Molecular Weight | 284.79 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 4-chloro-N-[1-(dimethylamino)propan-2-yl]-N-ethyl-2-hydroxybenzamide |
| SMILES | CCN(C(=O)c1ccc(Cl)cc1O)C(C)CN(C)C |
| InChI | InChI=1S/C14H21ClN2O2/c1-5-17(10(2)9-16(3)4)14(19)12-7-6-11(15)8-13(12)18/h6-8,10,18H,5,9H2,1-4H3 |
| InChIKey | OSCSBRNKTWAJGA-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.79 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |