C13H17NO2 — CID 115968436
2-hydroxy-N,5-dimethyl-N-(2-methylprop-2-enyl)benzamide (PubChem CID 115968436) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is 2-hydroxy-N,5-dimethyl-N-(2-methylprop-2-enyl)benzamide.
| Compound Name | 2-hydroxy-N,5-dimethyl-N-(2-methylprop-2-enyl)benzamide |
|---|---|
| PubChem CID | 115968436 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | 2-hydroxy-N,5-dimethyl-N-(2-methylprop-2-enyl)benzamide |
| SMILES | C=C(C)CN(C)C(=O)c1cc(C)ccc1O |
| InChI | InChI=1S/C13H17NO2/c1-9(2)8-14(4)13(16)11-7-10(3)5-6-12(11)15/h5-7,15H,1,8H2,2-4H3 |
| InChIKey | CHIKMJSMENXLJK-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|