C11H18N2O2 — CID 70549954
6-ethyl-1,3-benzodioxol-5-amine;N-methylmethanamine (PubChem CID 70549954) has the molecular formula C11H18N2O2 and a molecular weight of 210.28 g/mol. Its IUPAC name is 6-ethyl-1,3-benzodioxol-5-amine;N-methylmethanamine.
| Compound Name | 6-ethyl-1,3-benzodioxol-5-amine;N-methylmethanamine |
|---|---|
| PubChem CID | 70549954 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 6-ethyl-1,3-benzodioxol-5-amine;N-methylmethanamine |
| SMILES | CCc1cc2c(cc1N)OCO2.CNC |
| InChI | InChI=1S/C9H11NO2.C2H7N/c1-2-6-3-8-9(4-7(6)10)12-5-11-8;1-3-2/h3-4H,2,5,10H2,1H3;3H,1-2H3 |
| InChIKey | GNJKCTXVZDSTGO-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|