C9H12N2O4S — CID 43550435
N-(6-amino-1,3-benzodioxol-5-yl)ethanesulfonamide (PubChem CID 43550435) has the molecular formula C9H12N2O4S and a molecular weight of 244.27 g/mol. Its IUPAC name is N-(6-amino-1,3-benzodioxol-5-yl)ethanesulfonamide.
| Compound Name | N-(6-amino-1,3-benzodioxol-5-yl)ethanesulfonamide |
|---|---|
| PubChem CID | 43550435 |
| Molecular Formula | C9H12N2O4S |
| Molecular Weight | 244.27 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | N-(6-amino-1,3-benzodioxol-5-yl)ethanesulfonamide |
| SMILES | CCS(=O)(=O)Nc1cc2c(cc1N)OCO2 |
| InChI | InChI=1S/C9H12N2O4S/c1-2-16(12,13)11-7-4-9-8(3-6(7)10)14-5-15-9/h3-4,11H,2,5,10H2,1H3 |
| InChIKey | ZMVRXAZQGGCIIU-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.27 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|