C11H16N2O5S — CID 55010119
N-(7-amino-2,3-dihydro-1,4-benzodioxin-6-yl)-2-methoxyethanesulfonamide (PubChem CID 55010119) has the molecular formula C11H16N2O5S and a molecular weight of 288.33 g/mol. Its IUPAC name is N-(7-amino-2,3-dihydro-1,4-benzodioxin-6-yl)-2-methoxyethanesulfonamide.
| Compound Name | N-(7-amino-2,3-dihydro-1,4-benzodioxin-6-yl)-2-methoxyethanesulfonamide |
|---|---|
| PubChem CID | 55010119 |
| Molecular Formula | C11H16N2O5S |
| Molecular Weight | 288.33 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | N-(7-amino-2,3-dihydro-1,4-benzodioxin-6-yl)-2-methoxyethanesulfonamide |
| SMILES | COCCS(=O)(=O)Nc1cc2c(cc1N)OCCO2 |
| InChI | InChI=1S/C11H16N2O5S/c1-16-4-5-19(14,15)13-9-7-11-10(6-8(9)12)17-2-3-18-11/h6-7,13H,2-5,12H2,1H3 |
| InChIKey | XEMVTWBTBLZUGB-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.33 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|