C14H21N3O6S — CID 119618069
N-(6-amino-1,3-benzodioxol-5-yl)-2-(2-propan-2-yloxyethylsulfonylamino)acetamide (PubChem CID 119618069) has the molecular formula C14H21N3O6S and a molecular weight of 359.40 g/mol. Its IUPAC name is N-(6-amino-1,3-benzodioxol-5-yl)-2-(2-propan-2-yloxyethylsulfonylamino)acetamide.
| Compound Name | N-(6-amino-1,3-benzodioxol-5-yl)-2-(2-propan-2-yloxyethylsulfonylamino)acetamide |
|---|---|
| PubChem CID | 119618069 |
| Molecular Formula | C14H21N3O6S |
| Molecular Weight | 359.40 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | N-(6-amino-1,3-benzodioxol-5-yl)-2-(2-propan-2-yloxyethylsulfonylamino)acetamide |
| SMILES | CC(C)OCCS(=O)(=O)NCC(=O)Nc1cc2c(cc1N)OCO2 |
| InChI | InChI=1S/C14H21N3O6S/c1-9(2)21-3-4-24(19,20)16-7-14(18)17-11-6-13-12(5-10(11)15)22-8-23-13/h5-6,9,16H,3-4,7-8,15H2,1-2H3,(H,17,18) |
| InChIKey | GYRQKKSIMJGPLR-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 128.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.40 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|