C15H22N2O6S — CID 119352057
2-[3-[[2-(2-propan-2-yloxyethylsulfonylamino)acetyl]amino]phenyl]acetic acid (PubChem CID 119352057) has the molecular formula C15H22N2O6S and a molecular weight of 358.42 g/mol. Its IUPAC name is 2-[3-[[2-(2-propan-2-yloxyethylsulfonylamino)acetyl]amino]phenyl]acetic acid.
| Compound Name | 2-[3-[[2-(2-propan-2-yloxyethylsulfonylamino)acetyl]amino]phenyl]acetic acid |
|---|---|
| PubChem CID | 119352057 |
| Molecular Formula | C15H22N2O6S |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | 2-[3-[[2-(2-propan-2-yloxyethylsulfonylamino)acetyl]amino]phenyl]acetic acid |
| SMILES | CC(C)OCCS(=O)(=O)NCC(=O)Nc1cccc(CC(=O)O)c1 |
| InChI | InChI=1S/C15H22N2O6S/c1-11(2)23-6-7-24(21,22)16-10-14(18)17-13-5-3-4-12(8-13)9-15(19)20/h3-5,8,11,16H,6-7,9-10H2,1-2H3,(H,17,18)(H,19,20) |
| InChIKey | MLVIVLALDLSEOX-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |