C12H17NO4S — CID 43382367
7-(propylsulfonylmethyl)-2,3-dihydro-1,4-benzodioxin-6-amine (PubChem CID 43382367) has the molecular formula C12H17NO4S and a molecular weight of 271.34 g/mol. Its IUPAC name is 7-(propylsulfonylmethyl)-2,3-dihydro-1,4-benzodioxin-6-amine.
| Compound Name | 7-(propylsulfonylmethyl)-2,3-dihydro-1,4-benzodioxin-6-amine |
|---|---|
| PubChem CID | 43382367 |
| Molecular Formula | C12H17NO4S |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | 7-(propylsulfonylmethyl)-2,3-dihydro-1,4-benzodioxin-6-amine |
| SMILES | CCCS(=O)(=O)Cc1cc2c(cc1N)OCCO2 |
| InChI | InChI=1S/C12H17NO4S/c1-2-5-18(14,15)8-9-6-11-12(7-10(9)13)17-4-3-16-11/h6-7H,2-5,8,13H2,1H3 |
| InChIKey | VFAILNHVBFEQTD-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|