C14H21NO3S — CID 107753748
7-(3-methylbutan-2-ylsulfinylmethyl)-2,3-dihydro-1,4-benzodioxin-6-amine (PubChem CID 107753748) has the molecular formula C14H21NO3S and a molecular weight of 283.39 g/mol. Its IUPAC name is 7-(3-methylbutan-2-ylsulfinylmethyl)-2,3-dihydro-1,4-benzodioxin-6-amine.
| Compound Name | 7-(3-methylbutan-2-ylsulfinylmethyl)-2,3-dihydro-1,4-benzodioxin-6-amine |
|---|---|
| PubChem CID | 107753748 |
| Molecular Formula | C14H21NO3S |
| Molecular Weight | 283.39 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 7-(3-methylbutan-2-ylsulfinylmethyl)-2,3-dihydro-1,4-benzodioxin-6-amine |
| SMILES | CC(C)C(C)S(=O)Cc1cc2c(cc1N)OCCO2 |
| InChI | InChI=1S/C14H21NO3S/c1-9(2)10(3)19(16)8-11-6-13-14(7-12(11)15)18-5-4-17-13/h6-7,9-10H,4-5,8,15H2,1-3H3 |
| InChIKey | SLKDTJZHKSVQAK-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.39 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|