C16H25N3O2 — CID 43585758
1-[(6-amino-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]-N,N-dimethylpiperidin-4-amine (PubChem CID 43585758) has the molecular formula C16H25N3O2 and a molecular weight of 291.40 g/mol. Its IUPAC name is 1-[(6-amino-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]-N,N-dimethylpiperidin-4-amine.
| Compound Name | 1-[(6-amino-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]-N,N-dimethylpiperidin-4-amine |
|---|---|
| PubChem CID | 43585758 |
| Molecular Formula | C16H25N3O2 |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.19 |
| IUPAC Name | 1-[(6-amino-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]-N,N-dimethylpiperidin-4-amine |
| SMILES | CN(C)C1CCN(Cc2cc3c(cc2N)OCCO3)CC1 |
| InChI | InChI=1S/C16H25N3O2/c1-18(2)13-3-5-19(6-4-13)11-12-9-15-16(10-14(12)17)21-8-7-20-15/h9-10,13H,3-8,11,17H2,1-2H3 |
| InChIKey | UGQCMIVPQJKDSI-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 50.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|