C14H21NO4 — CID 43260058
7-(2-propan-2-yloxyethoxymethyl)-2,3-dihydro-1,4-benzodioxin-6-amine (PubChem CID 43260058) has the molecular formula C14H21NO4 and a molecular weight of 267.32 g/mol. Its IUPAC name is 7-(2-propan-2-yloxyethoxymethyl)-2,3-dihydro-1,4-benzodioxin-6-amine.
| Compound Name | 7-(2-propan-2-yloxyethoxymethyl)-2,3-dihydro-1,4-benzodioxin-6-amine |
|---|---|
| PubChem CID | 43260058 |
| Molecular Formula | C14H21NO4 |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | 7-(2-propan-2-yloxyethoxymethyl)-2,3-dihydro-1,4-benzodioxin-6-amine |
| SMILES | CC(C)OCCOCc1cc2c(cc1N)OCCO2 |
| InChI | InChI=1S/C14H21NO4/c1-10(2)17-4-3-16-9-11-7-13-14(8-12(11)15)19-6-5-18-13/h7-8,10H,3-6,9,15H2,1-2H3 |
| InChIKey | RCEDUJJUJOFBRE-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 62.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|