C17H27NO3 — CID 43260166
7-(2-ethylhexoxymethyl)-2,3-dihydro-1,4-benzodioxin-6-amine (PubChem CID 43260166) has the molecular formula C17H27NO3 and a molecular weight of 293.41 g/mol. Its IUPAC name is 7-(2-ethylhexoxymethyl)-2,3-dihydro-1,4-benzodioxin-6-amine.
| Compound Name | 7-(2-ethylhexoxymethyl)-2,3-dihydro-1,4-benzodioxin-6-amine |
|---|---|
| PubChem CID | 43260166 |
| Molecular Formula | C17H27NO3 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.20 |
| IUPAC Name | 7-(2-ethylhexoxymethyl)-2,3-dihydro-1,4-benzodioxin-6-amine |
| SMILES | CCCCC(CC)COCc1cc2c(cc1N)OCCO2 |
| InChI | InChI=1S/C17H27NO3/c1-3-5-6-13(4-2)11-19-12-14-9-16-17(10-15(14)18)21-8-7-20-16/h9-10,13H,3-8,11-12,18H2,1-2H3 |
| InChIKey | KNTRBVVYDJMSNP-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|