C9H3F8NO2 — CID 131953291
1-fluoro-4-(1,1,2,2,3,3,3-heptafluoropropyl)-2-nitrobenzene (PubChem CID 131953291) has the molecular formula C9H3F8NO2 and a molecular weight of 309.11 g/mol. Its IUPAC name is 1-fluoro-4-(1,1,2,2,3,3,3-heptafluoropropyl)-2-nitrobenzene.
| Compound Name | 1-fluoro-4-(1,1,2,2,3,3,3-heptafluoropropyl)-2-nitrobenzene |
|---|---|
| PubChem CID | 131953291 |
| Molecular Formula | C9H3F8NO2 |
| Molecular Weight | 309.11 g/mol |
| Exact Mass | 309.00 |
| IUPAC Name | 1-fluoro-4-(1,1,2,2,3,3,3-heptafluoropropyl)-2-nitrobenzene |
| SMILES | O=[N+]([O-])c1cc(C(F)(F)C(F)(F)C(F)(F)F)ccc1F |
| InChI | InChI=1S/C9H3F8NO2/c10-5-2-1-4(3-6(5)18(19)20)7(11,12)8(13,14)9(15,16)17/h1-3H |
| InChIKey | GDHJEAMXBDOEHE-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.11 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|