C9H3ClF5NO3 — CID 54529475
2-nitro-4-(1,1,2,2,2-pentafluoroethyl)benzoyl chloride (PubChem CID 54529475) has the molecular formula C9H3ClF5NO3 and a molecular weight of 303.57 g/mol. Its IUPAC name is 2-nitro-4-(1,1,2,2,2-pentafluoroethyl)benzoyl chloride.
| Compound Name | 2-nitro-4-(1,1,2,2,2-pentafluoroethyl)benzoyl chloride |
|---|---|
| PubChem CID | 54529475 |
| Molecular Formula | C9H3ClF5NO3 |
| Molecular Weight | 303.57 g/mol |
| Exact Mass | 302.97 |
| IUPAC Name | 2-nitro-4-(1,1,2,2,2-pentafluoroethyl)benzoyl chloride |
| SMILES | O=C(Cl)c1ccc(C(F)(F)C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H3ClF5NO3/c10-7(17)5-2-1-4(3-6(5)16(18)19)8(11,12)9(13,14)15/h1-3H |
| InChIKey | YVMHLAXLKISVKN-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.57 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|