C13H18O3S — CID 117037518
[1-(2,5-dimethylphenyl)sulfonylcyclobutyl]methanol (PubChem CID 117037518) has the molecular formula C13H18O3S and a molecular weight of 254.35 g/mol. Its IUPAC name is [1-(2,5-dimethylphenyl)sulfonylcyclobutyl]methanol.
| Compound Name | [1-(2,5-dimethylphenyl)sulfonylcyclobutyl]methanol |
|---|---|
| PubChem CID | 117037518 |
| Molecular Formula | C13H18O3S |
| Molecular Weight | 254.35 g/mol |
| Exact Mass | 254.10 |
| IUPAC Name | [1-(2,5-dimethylphenyl)sulfonylcyclobutyl]methanol |
| SMILES | Cc1ccc(C)c(S(=O)(=O)C2(CO)CCC2)c1 |
| InChI | InChI=1S/C13H18O3S/c1-10-4-5-11(2)12(8-10)17(15,16)13(9-14)6-3-7-13/h4-5,8,14H,3,6-7,9H2,1-2H3 |
| InChIKey | OMOPRKHSJLNRTJ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.35 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |