C13H15NO2S — CID 43519420
1-(2,5-dimethylphenyl)sulfonylcyclobutane-1-carbonitrile (PubChem CID 43519420) has the molecular formula C13H15NO2S and a molecular weight of 249.33 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)sulfonylcyclobutane-1-carbonitrile.
| Compound Name | 1-(2,5-dimethylphenyl)sulfonylcyclobutane-1-carbonitrile |
|---|---|
| PubChem CID | 43519420 |
| Molecular Formula | C13H15NO2S |
| Molecular Weight | 249.33 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | 1-(2,5-dimethylphenyl)sulfonylcyclobutane-1-carbonitrile |
| SMILES | Cc1ccc(C)c(S(=O)(=O)C2(C#N)CCC2)c1 |
| InChI | InChI=1S/C13H15NO2S/c1-10-4-5-11(2)12(8-10)17(15,16)13(9-14)6-3-7-13/h4-5,8H,3,6-7H2,1-2H3 |
| InChIKey | BWGHUWZLKAXKGR-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.33 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |