C35H40O7 — CID 70557492
[(1R,2R,3R,4R)-2-(dimethoxymethyl)-3-(7-methoxy-7-oxohept-3-enyl)-4-phenoxycyclopentyl] 4-phenylbenzoate (PubChem CID 70557492) has the molecular formula C35H40O7 and a molecular weight of 572.70 g/mol. Its IUPAC name is [(1R,2R,3R,4R)-2-(dimethoxymethyl)-3-(7-methoxy-7-oxohept-3-enyl)-4-phenoxycyclopentyl] 4-phenylbenzoate.
| Compound Name | [(1R,2R,3R,4R)-2-(dimethoxymethyl)-3-(7-methoxy-7-oxohept-3-enyl)-4-phenoxycyclopentyl] 4-phenylbenzoate |
|---|---|
| PubChem CID | 70557492 |
| Molecular Formula | C35H40O7 |
| Molecular Weight | 572.70 g/mol |
| Exact Mass | 572.28 |
| IUPAC Name | [(1R,2R,3R,4R)-2-(dimethoxymethyl)-3-(7-methoxy-7-oxohept-3-enyl)-4-phenoxycyclopentyl] 4-phenylbenzoate |
| SMILES | COC(=O)CCC=CCC[C@@H]1[C@@H](C(OC)OC)[C@H](OC(=O)c2ccc(-c3ccccc3)cc2)C[C@H]1Oc1ccccc1 |
| InChI | InChI=1S/C35H40O7/c1-38-32(36)19-13-5-4-12-18-29-30(41-28-16-10-7-11-17-28)24-31(33(29)35(39-2)40-3)42-34(37)27-22-20-26(21-23-27)25-14-8-6-9-15-25/h4-11,14-17,20-23,29-31,33,35H,12-13,18-19,24H2,1-3H3/t29-,30+,31+,33+/m0/s1 |
| InChIKey | JCCCCBJXWKKPGD-AMTAJSKDSA-N |
| XLogP | 6.87 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.70 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|