C55H61FO7 — CID 123679043
[2-(5-fluoro-3,4-dimethyl-6-phenoxyhexyl)-3-(7-oxo-7-propan-2-yloxyhept-2-enyl)-4-(4-phenylbenzoyl)oxycyclopentyl] 4-phenylbenzoate (PubChem CID 123679043) has the molecular formula C55H61FO7 and a molecular weight of 853.08 g/mol. Its IUPAC name is [2-(5-fluoro-3,4-dimethyl-6-phenoxyhexyl)-3-(7-oxo-7-propan-2-yloxyhept-2-enyl)-4-(4-phenylbenzoyl)oxycyclopentyl] 4-phenylbenzoate.
| Compound Name | [2-(5-fluoro-3,4-dimethyl-6-phenoxyhexyl)-3-(7-oxo-7-propan-2-yloxyhept-2-enyl)-4-(4-phenylbenzoyl)oxycyclopentyl] 4-phenylbenzoate |
|---|---|
| PubChem CID | 123679043 |
| Molecular Formula | C55H61FO7 |
| Molecular Weight | 853.08 g/mol |
| Exact Mass | 852.44 |
| IUPAC Name | [2-(5-fluoro-3,4-dimethyl-6-phenoxyhexyl)-3-(7-oxo-7-propan-2-yloxyhept-2-enyl)-4-(4-phenylbenzoyl)oxycyclopentyl] 4-phenylbenzoate |
| SMILES | CC(C)OC(=O)CCCC=CCC1C(OC(=O)c2ccc(-c3ccccc3)cc2)CC(OC(=O)c2ccc(-c3ccccc3)cc2)C1CCC(C)C(C)C(F)COc1ccccc1 |
| InChI | InChI=1S/C55H61FO7/c1-38(2)61-53(57)25-17-6-5-16-24-48-49(35-26-39(3)40(4)50(56)37-60-47-22-14-9-15-23-47)52(63-55(59)46-33-29-44(30-34-46)42-20-12-8-13-21-42)36-51(48)62-54(58)45-31-27-43(28-32-45)41-18-10-7-11-19-41/h5,7-16,18-23,27-34,38-40,48-52H,6,17,24-26,35-37H2,1-4H3 |
| InChIKey | IMCWREOWGYSGKC-UHFFFAOYSA-N |
| XLogP | 12.95 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 853.08 |
| LogP ≤ 5 | 12.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|