C20H32O7 — CID 88781098
7-[(1R,2R,3R,4S,5R)-3-(dimethoxymethyl)-4-(oxan-2-yloxy)-6-oxabicyclo[3.1.0]hexan-2-yl]hept-5-enoic acid (PubChem CID 88781098) has the molecular formula C20H32O7 and a molecular weight of 384.47 g/mol. Its IUPAC name is 7-[(1R,2R,3R,4S,5R)-3-(dimethoxymethyl)-4-(oxan-2-yloxy)-6-oxabicyclo[3.1.0]hexan-2-yl]hept-5-enoic acid.
| Compound Name | 7-[(1R,2R,3R,4S,5R)-3-(dimethoxymethyl)-4-(oxan-2-yloxy)-6-oxabicyclo[3.1.0]hexan-2-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 88781098 |
| Molecular Formula | C20H32O7 |
| Molecular Weight | 384.47 g/mol |
| Exact Mass | 384.21 |
| IUPAC Name | 7-[(1R,2R,3R,4S,5R)-3-(dimethoxymethyl)-4-(oxan-2-yloxy)-6-oxabicyclo[3.1.0]hexan-2-yl]hept-5-enoic acid |
| SMILES | COC(OC)[C@@H]1[C@@H](CC=CCCCC(=O)O)[C@H]2O[C@H]2[C@H]1OC1CCCCO1 |
| InChI | InChI=1S/C20H32O7/c1-23-20(24-2)16-13(9-5-3-4-6-10-14(21)22)17-19(27-17)18(16)26-15-11-7-8-12-25-15/h3,5,13,15-20H,4,6-12H2,1-2H3,(H,21,22)/t13-,15?,16-,17-,18+,19-/m1/s1 |
| InChIKey | MTPCFPMWQPIFTD-WIZLMEDUSA-N |
| XLogP | 2.73 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.47 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|