C18H30O7S — CID 88809047
methyl 7-[(2S,3S,4R)-3-formyl-4-(oxan-2-yloxy)-1,1-dioxothiolan-2-yl]heptanoate (PubChem CID 88809047) has the molecular formula C18H30O7S and a molecular weight of 390.50 g/mol. Its IUPAC name is methyl 7-[(2S,3S,4R)-3-formyl-4-(oxan-2-yloxy)-1,1-dioxothiolan-2-yl]heptanoate.
| Compound Name | methyl 7-[(2S,3S,4R)-3-formyl-4-(oxan-2-yloxy)-1,1-dioxothiolan-2-yl]heptanoate |
|---|---|
| PubChem CID | 88809047 |
| Molecular Formula | C18H30O7S |
| Molecular Weight | 390.50 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | methyl 7-[(2S,3S,4R)-3-formyl-4-(oxan-2-yloxy)-1,1-dioxothiolan-2-yl]heptanoate |
| SMILES | COC(=O)CCCCCC[C@H]1[C@H](C=O)[C@@H](OC2CCCCO2)CS1(=O)=O |
| InChI | InChI=1S/C18H30O7S/c1-23-17(20)9-5-3-2-4-8-16-14(12-19)15(13-26(16,21)22)25-18-10-6-7-11-24-18/h12,14-16,18H,2-11,13H2,1H3/t14-,15+,16+,18?/m1/s1 |
| InChIKey | HOSAGQMGBWFHSB-PGQZYJQNSA-N |
| XLogP | 2.02 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.50 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|