C23H38O7 — CID 22807252
(E)-7-[(1R,2S,3R,5S)-2-(hydroxymethyl)-3,5-bis(oxan-2-yloxy)cyclopentyl]hept-2-enoic acid (PubChem CID 22807252) has the molecular formula C23H38O7 and a molecular weight of 426.55 g/mol. Its IUPAC name is (E)-7-[(1R,2S,3R,5S)-2-(hydroxymethyl)-3,5-bis(oxan-2-yloxy)cyclopentyl]hept-2-enoic acid.
| Compound Name | (E)-7-[(1R,2S,3R,5S)-2-(hydroxymethyl)-3,5-bis(oxan-2-yloxy)cyclopentyl]hept-2-enoic acid |
|---|---|
| PubChem CID | 22807252 |
| Molecular Formula | C23H38O7 |
| Molecular Weight | 426.55 g/mol |
| Exact Mass | 426.26 |
| IUPAC Name | (E)-7-[(1R,2S,3R,5S)-2-(hydroxymethyl)-3,5-bis(oxan-2-yloxy)cyclopentyl]hept-2-enoic acid |
| SMILES | O=C(O)/C=C/CCCC[C@@H]1[C@@H](CO)[C@H](OC2CCCCO2)C[C@@H]1OC1CCCCO1 |
| InChI | InChI=1S/C23H38O7/c24-16-18-17(9-3-1-2-4-10-21(25)26)19(29-22-11-5-7-13-27-22)15-20(18)30-23-12-6-8-14-28-23/h4,10,17-20,22-24H,1-3,5-9,11-16H2,(H,25,26)/b10-4+/t17-,18-,19+,20-,22?,23?/m1/s1 |
| InChIKey | GUVGYENBJFTXRF-FOQQSYLNSA-N |
| XLogP | 3.64 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.55 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|