C33H51O9P — CID 57137607
methyl 7-[(2R,3S,5R)-2-[[methoxy(2-phenylethyl)phosphoryl]oxymethyl]-3,5-bis(oxan-2-yloxy)cyclopentyl]hept-2-enoate (PubChem CID 57137607) has the molecular formula C33H51O9P and a molecular weight of 622.74 g/mol. Its IUPAC name is methyl 7-[(2R,3S,5R)-2-[[methoxy(2-phenylethyl)phosphoryl]oxymethyl]-3,5-bis(oxan-2-yloxy)cyclopentyl]hept-2-enoate.
| Compound Name | methyl 7-[(2R,3S,5R)-2-[[methoxy(2-phenylethyl)phosphoryl]oxymethyl]-3,5-bis(oxan-2-yloxy)cyclopentyl]hept-2-enoate |
|---|---|
| PubChem CID | 57137607 |
| Molecular Formula | C33H51O9P |
| Molecular Weight | 622.74 g/mol |
| Exact Mass | 622.33 |
| IUPAC Name | methyl 7-[(2R,3S,5R)-2-[[methoxy(2-phenylethyl)phosphoryl]oxymethyl]-3,5-bis(oxan-2-yloxy)cyclopentyl]hept-2-enoate |
| SMILES | COC(=O)C=CCCCCC1[C@H](OC2CCCCO2)C[C@H](OC2CCCCO2)[C@H]1COP(=O)(CCc1ccccc1)OC |
| InChI | InChI=1S/C33H51O9P/c1-36-31(34)17-9-4-3-8-16-27-28(25-40-43(35,37-2)23-20-26-14-6-5-7-15-26)30(42-33-19-11-13-22-39-33)24-29(27)41-32-18-10-12-21-38-32/h5-7,9,14-15,17,27-30,32-33H,3-4,8,10-13,16,18-25H2,1-2H3/t27?,28-,29+,30-,32?,33?,43?/m0/s1 |
| InChIKey | KQZXWCKGQPFPFZ-XGWLRGMVSA-N |
| XLogP | 6.83 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.74 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|