C39H44O5SSi — CID 67000399
(E)-7-[(1R,2R,5S)-2-[(E,3R)-3-(1-benzothiophen-2-yl)-3-[tert-butyl(diphenyl)silyl]oxyprop-1-enyl]-5-hydroxy-3-oxocyclopentyl]hept-5-enoic acid (PubChem CID 67000399) has the molecular formula C39H44O5SSi and a molecular weight of 652.93 g/mol. Its IUPAC name is (E)-7-[(1R,2R,5S)-2-[(E,3R)-3-(1-benzothiophen-2-yl)-3-[tert-butyl(diphenyl)silyl]oxyprop-1-enyl]-5-hydroxy-3-oxocyclopentyl]hept-5-enoic acid.
| Compound Name | (E)-7-[(1R,2R,5S)-2-[(E,3R)-3-(1-benzothiophen-2-yl)-3-[tert-butyl(diphenyl)silyl]oxyprop-1-enyl]-5-hydroxy-3-oxocyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 67000399 |
| Molecular Formula | C39H44O5SSi |
| Molecular Weight | 652.93 g/mol |
| Exact Mass | 652.27 |
| IUPAC Name | (E)-7-[(1R,2R,5S)-2-[(E,3R)-3-(1-benzothiophen-2-yl)-3-[tert-butyl(diphenyl)silyl]oxyprop-1-enyl]-5-hydroxy-3-oxocyclopentyl]hept-5-enoic acid |
| SMILES | CC(C)(C)[Si](O[C@H](/C=C/[C@H]1C(=O)C[C@H](O)[C@@H]1C/C=C/CCCC(=O)O)c1cc2ccccc2s1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C39H44O5SSi/c1-39(2,3)46(29-17-8-6-9-18-29,30-19-10-7-11-20-30)44-35(37-26-28-16-14-15-22-36(28)45-37)25-24-32-31(33(40)27-34(32)41)21-12-4-5-13-23-38(42)43/h4,6-12,14-20,22,24-26,31-33,35,40H,5,13,21,23,27H2,1-3H3,(H,42,43)/b12-4+,25-24+/t31-,32-,33+,35-/m1/s1 |
| InChIKey | AVVLVAANBKUOGB-NFCMTKEGSA-N |
| XLogP | 7.84 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.93 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|