C38H43NO5SSi — CID 70670679
(Z)-7-[(1R,2R,5S)-2-[(E,3R)-3-(1,3-benzothiazol-2-yl)-5-[hydroxy(diphenyl)silyl]-5-methylhex-1-enyl]-5-hydroxy-3-oxocyclopentyl]hept-5-enoic acid (PubChem CID 70670679) has the molecular formula C38H43NO5SSi and a molecular weight of 653.92 g/mol. Its IUPAC name is (Z)-7-[(1R,2R,5S)-2-[(E,3R)-3-(1,3-benzothiazol-2-yl)-5-[hydroxy(diphenyl)silyl]-5-methylhex-1-enyl]-5-hydroxy-3-oxocyclopentyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,2R,5S)-2-[(E,3R)-3-(1,3-benzothiazol-2-yl)-5-[hydroxy(diphenyl)silyl]-5-methylhex-1-enyl]-5-hydroxy-3-oxocyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 70670679 |
| Molecular Formula | C38H43NO5SSi |
| Molecular Weight | 653.92 g/mol |
| Exact Mass | 653.26 |
| IUPAC Name | (Z)-7-[(1R,2R,5S)-2-[(E,3R)-3-(1,3-benzothiazol-2-yl)-5-[hydroxy(diphenyl)silyl]-5-methylhex-1-enyl]-5-hydroxy-3-oxocyclopentyl]hept-5-enoic acid |
| SMILES | CC(C)(C[C@H](/C=C/[C@H]1C(=O)C[C@H](O)[C@@H]1C/C=C\CCCC(=O)O)c1nc2ccccc2s1)[Si](O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C38H43NO5SSi/c1-38(2,46(44,28-15-7-5-8-16-28)29-17-9-6-10-18-29)26-27(37-39-32-20-13-14-21-35(32)45-37)23-24-31-30(33(40)25-34(31)41)19-11-3-4-12-22-36(42)43/h3,5-11,13-18,20-21,23-24,27,30-31,33,40,44H,4,12,19,22,25-26H2,1-2H3,(H,42,43)/b11-3-,24-23+/t27-,30+,31+,33-/m0/s1 |
| InChIKey | FSUCYZKKFNQIHR-DZLHYIRCSA-N |
| XLogP | 6.63 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.92 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|