C33H35NO4SSi — CID 71011331
(3aR,4R,5R,6aS)-4-[(E,3R)-3-(1,3-benzothiazol-2-yl)-5-[hydroxy(diphenyl)silyl]-5-methylhex-1-enyl]-5-hydroxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one (PubChem CID 71011331) has the molecular formula C33H35NO4SSi and a molecular weight of 569.80 g/mol. Its IUPAC name is (3aR,4R,5R,6aS)-4-[(E,3R)-3-(1,3-benzothiazol-2-yl)-5-[hydroxy(diphenyl)silyl]-5-methylhex-1-enyl]-5-hydroxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one.
| Compound Name | (3aR,4R,5R,6aS)-4-[(E,3R)-3-(1,3-benzothiazol-2-yl)-5-[hydroxy(diphenyl)silyl]-5-methylhex-1-enyl]-5-hydroxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 71011331 |
| Molecular Formula | C33H35NO4SSi |
| Molecular Weight | 569.80 g/mol |
| Exact Mass | 569.21 |
| IUPAC Name | (3aR,4R,5R,6aS)-4-[(E,3R)-3-(1,3-benzothiazol-2-yl)-5-[hydroxy(diphenyl)silyl]-5-methylhex-1-enyl]-5-hydroxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
| SMILES | CC(C)(C[C@H](/C=C/[C@@H]1[C@H]2CC(=O)O[C@H]2C[C@H]1O)c1nc2ccccc2s1)[Si](O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H35NO4SSi/c1-33(2,40(37,23-11-5-3-6-12-23)24-13-7-4-8-14-24)21-22(32-34-27-15-9-10-16-30(27)39-32)17-18-25-26-19-31(36)38-29(26)20-28(25)35/h3-18,22,25-26,28-29,35,37H,19-21H2,1-2H3/b18-17+/t22-,25+,26+,28+,29-/m0/s1 |
| InChIKey | XRMIZAJJCQFNTH-VXSFAGMGSA-N |
| XLogP | 5.17 |
| TPSA | 79.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.80 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|