C38H43NO5SSi — CID 66999971
7-[(1R,2R,3R)-2-[3-(1,3-benzothiazol-2-yl)-3-[tert-butyl(diphenyl)silyl]oxyprop-1-enyl]-3-hydroxy-5-oxocyclopentyl]hept-5-enoic acid (PubChem CID 66999971) has the molecular formula C38H43NO5SSi and a molecular weight of 653.92 g/mol. Its IUPAC name is 7-[(1R,2R,3R)-2-[3-(1,3-benzothiazol-2-yl)-3-[tert-butyl(diphenyl)silyl]oxyprop-1-enyl]-3-hydroxy-5-oxocyclopentyl]hept-5-enoic acid.
| Compound Name | 7-[(1R,2R,3R)-2-[3-(1,3-benzothiazol-2-yl)-3-[tert-butyl(diphenyl)silyl]oxyprop-1-enyl]-3-hydroxy-5-oxocyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 66999971 |
| Molecular Formula | C38H43NO5SSi |
| Molecular Weight | 653.92 g/mol |
| Exact Mass | 653.26 |
| IUPAC Name | 7-[(1R,2R,3R)-2-[3-(1,3-benzothiazol-2-yl)-3-[tert-butyl(diphenyl)silyl]oxyprop-1-enyl]-3-hydroxy-5-oxocyclopentyl]hept-5-enoic acid |
| SMILES | CC(C)(C)[Si](OC(C=C[C@H]1[C@H](O)CC(=O)[C@@H]1CC=CCCCC(=O)O)c1nc2ccccc2s1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C38H43NO5SSi/c1-38(2,3)46(27-16-8-6-9-17-27,28-18-10-7-11-19-28)44-34(37-39-31-21-14-15-22-35(31)45-37)25-24-30-29(32(40)26-33(30)41)20-12-4-5-13-23-36(42)43/h4,6-12,14-19,21-22,24-25,29-30,33-34,41H,5,13,20,23,26H2,1-3H3,(H,42,43)/t29-,30-,33-,34?/m1/s1 |
| InChIKey | PLCWCADCSALGSP-IJRNHITCSA-N |
| XLogP | 7.24 |
| TPSA | 96.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.92 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|