C39H45NO5SSi — CID 67000767
(Z)-7-[(1R,2R,3R)-2-[(E,3R)-3-(1,3-benzothiazol-2-yl)-3-[tert-butyl(diphenyl)silyl]oxyprop-1-enyl]-3-hydroxy-5-oxocyclopentyl]-2-methylhept-5-enoic acid (PubChem CID 67000767) has the molecular formula C39H45NO5SSi and a molecular weight of 667.94 g/mol. Its IUPAC name is (Z)-7-[(1R,2R,3R)-2-[(E,3R)-3-(1,3-benzothiazol-2-yl)-3-[tert-butyl(diphenyl)silyl]oxyprop-1-enyl]-3-hydroxy-5-oxocyclopentyl]-2-methylhept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,2R,3R)-2-[(E,3R)-3-(1,3-benzothiazol-2-yl)-3-[tert-butyl(diphenyl)silyl]oxyprop-1-enyl]-3-hydroxy-5-oxocyclopentyl]-2-methylhept-5-enoic acid |
|---|---|
| PubChem CID | 67000767 |
| Molecular Formula | C39H45NO5SSi |
| Molecular Weight | 667.94 g/mol |
| Exact Mass | 667.28 |
| IUPAC Name | (Z)-7-[(1R,2R,3R)-2-[(E,3R)-3-(1,3-benzothiazol-2-yl)-3-[tert-butyl(diphenyl)silyl]oxyprop-1-enyl]-3-hydroxy-5-oxocyclopentyl]-2-methylhept-5-enoic acid |
| SMILES | CC(CC/C=C\C[C@H]1C(=O)C[C@@H](O)[C@@H]1/C=C/[C@@H](O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)c1nc2ccccc2s1)C(=O)O |
| InChI | InChI=1S/C39H45NO5SSi/c1-27(38(43)44)16-8-5-13-21-30-31(34(42)26-33(30)41)24-25-35(37-40-32-22-14-15-23-36(32)46-37)45-47(39(2,3)4,28-17-9-6-10-18-28)29-19-11-7-12-20-29/h5-7,9-15,17-20,22-25,27,30-31,34-35,42H,8,16,21,26H2,1-4H3,(H,43,44)/b13-5-,25-24+/t27?,30-,31-,34-,35-/m1/s1 |
| InChIKey | BLMSXRZVJQXRIK-AKJYRYOLSA-N |
| XLogP | 7.48 |
| TPSA | 96.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.94 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|